C14H30O2Si — CID 11459587
2,2-dimethyl-3-tri(propan-2-yl)silyloxypropanal (PubChem CID 11459587) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is 2,2-dimethyl-3-tri(propan-2-yl)silyloxypropanal.
| Compound Name | 2,2-dimethyl-3-tri(propan-2-yl)silyloxypropanal |
|---|---|
| PubChem CID | 11459587 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 2,2-dimethyl-3-tri(propan-2-yl)silyloxypropanal |
| SMILES | CC(C)[Si](OCC(C)(C)C=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-11(2)17(12(3)4,13(5)6)16-10-14(7,8)9-15/h9,11-13H,10H2,1-8H3 |
| InChIKey | HDNLXYJNNSNMGE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|