About 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one
2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one (PubChem CID 114596662) has the molecular formula C18H27NO
and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one |
| PubChem CID | 114596662 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one |
| SMILES | CC1CC(C)C(C)N(CC(C)C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H27NO/c1-13-10-14(2)16(4)19(11-13)12-15(3)18(20)17-8-6-5-7-9-17/h5-9,13-16H,10-12H2,1-4H3 |
| InChIKey | IUPGZBWBICLLLM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one?
The IUPAC name of 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one (CID 114596662) is 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one.
What is the SMILES notation for 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one?
The canonical SMILES for 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one is CC1CC(C)C(C)N(CC(C)C(=O)c2ccccc2)C1.
What is the InChIKey of 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one?
The InChIKey is IUPGZBWBICLLLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO/c1-13-10-14(2)16(4)19(11-13)12-15(3)18(20)17-8-6-5-7-9-17/h5-9,13-16H,10-12H2,1-4H3.
What are the key properties of 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one?
2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one has a molecular weight of 273.42 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-phenyl-3-(2,3,5-trimethylpiperidin-1-yl)propan-1-one is sourced from PubChem (CID 114596662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).