About 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde
3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde (PubChem CID 114596687) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde.
Molecular Properties
| Compound Name | 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde |
| PubChem CID | 114596687 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde |
| SMILES | CC1CC(C)C(C)N(CC2(C=O)CCCOC2)C1 |
| InChI | InChI=1S/C15H27NO2/c1-12-7-13(2)14(3)16(8-12)9-15(10-17)5-4-6-18-11-15/h10,12-14H,4-9,11H2,1-3H3 |
| InChIKey | QWAZOGVESCRIOE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde?
The IUPAC name of 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde (CID 114596687) is 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde.
What is the SMILES notation for 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde?
The canonical SMILES for 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde is CC1CC(C)C(C)N(CC2(C=O)CCCOC2)C1.
What is the InChIKey of 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde?
The InChIKey is QWAZOGVESCRIOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-12-7-13(2)14(3)16(8-12)9-15(10-17)5-4-6-18-11-15/h10,12-14H,4-9,11H2,1-3H3.
What are the key properties of 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde?
3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde has a molecular weight of 253.39 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3,5-trimethylpiperidin-1-yl)methyl]oxane-3-carbaldehyde is sourced from PubChem (CID 114596687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).