About N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine
N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine (PubChem CID 114597222) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine |
| PubChem CID | 114597222 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine |
| SMILES | C=CCNCC(C)N1CC(C)CC(C)C1C |
| InChI | InChI=1S/C14H28N2/c1-6-7-15-9-13(4)16-10-11(2)8-12(3)14(16)5/h6,11-15H,1,7-10H2,2-5H3 |
| InChIKey | ACXVVGYDCQEWOQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine?
The IUPAC name of N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine (CID 114597222) is N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine.
What is the SMILES notation for N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine?
The canonical SMILES for N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine is C=CCNCC(C)N1CC(C)CC(C)C1C.
What is the InChIKey of N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine?
The InChIKey is ACXVVGYDCQEWOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2/c1-6-7-15-9-13(4)16-10-11(2)8-12(3)14(16)5/h6,11-15H,1,7-10H2,2-5H3.
What are the key properties of N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine?
N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine has a molecular weight of 224.39 g/mol, XLogP of 2.52, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-2-(2,3,5-trimethylpiperidin-1-yl)propan-1-amine is sourced from PubChem (CID 114597222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).