About N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine
N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine (PubChem CID 114597734) has the molecular formula C15H26N2O2S2
and a molecular weight of 330.52 g/mol. Its IUPAC name is N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine |
| PubChem CID | 114597734 |
| Molecular Formula | C15H26N2O2S2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine |
| SMILES | CCNCc1sccc1S(=O)(=O)N1CC(C)CC(C)C1C |
| InChI | InChI=1S/C15H26N2O2S2/c1-5-16-9-14-15(6-7-20-14)21(18,19)17-10-11(2)8-12(3)13(17)4/h6-7,11-13,16H,5,8-10H2,1-4H3 |
| InChIKey | ORXNYKHIUZUFGV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine?
The IUPAC name of N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine (CID 114597734) is N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine.
What is the SMILES notation for N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine?
The canonical SMILES for N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine is CCNCc1sccc1S(=O)(=O)N1CC(C)CC(C)C1C.
What is the InChIKey of N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine?
The InChIKey is ORXNYKHIUZUFGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O2S2/c1-5-16-9-14-15(6-7-20-14)21(18,19)17-10-11(2)8-12(3)13(17)4/h6-7,11-13,16H,5,8-10H2,1-4H3.
What are the key properties of N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine?
N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine has a molecular weight of 330.52 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(2,3,5-trimethylpiperidin-1-yl)sulfonylthiophen-2-yl]methyl]ethanamine is sourced from PubChem (CID 114597734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).