C12H14N2O5 — CID 11459791
1-[(2R,3aR,6R,6aR)-3a,6-dihydroxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 11459791) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 1-[(2R,3aR,6R,6aR)-3a,6-dihydroxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3aR,6R,6aR)-3a,6-dihydroxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11459791 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-[(2R,3aR,6R,6aR)-3a,6-dihydroxy-2,3,6,6a-tetrahydrocyclopenta[b]furan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@@]3(O)C=C[C@@H](O)[C@H]3O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H14N2O5/c1-6-5-14(11(17)13-10(6)16)8-4-12(18)3-2-7(15)9(12)19-8/h2-3,5,7-9,15,18H,4H2,1H3,(H,13,16,17)/t7-,8-,9-,12+/m1/s1 |
| InChIKey | LRQJZBLQYSHGNI-HNBLOZHYSA-N |
| XLogP | -1.21 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|