About O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate
O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate (PubChem CID 11459805) has the molecular formula C10H9F3OS2
and a molecular weight of 266.31 g/mol. Its IUPAC name is O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate |
| PubChem CID | 11459805 |
| Molecular Formula | C10H9F3OS2 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate |
| SMILES | FC(F)(F)SC(=S)OCCc1ccccc1 |
| InChI | InChI=1S/C10H9F3OS2/c11-10(12,13)16-9(15)14-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | PNMJFKQOMSUJME-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate?
The IUPAC name of O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate (CID 11459805) is O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate.
What is the SMILES notation for O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate?
The canonical SMILES for O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate is FC(F)(F)SC(=S)OCCc1ccccc1.
What is the InChIKey of O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate?
The InChIKey is PNMJFKQOMSUJME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3OS2/c11-10(12,13)16-9(15)14-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate?
O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate has a molecular weight of 266.31 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-phenylethyl) trifluoromethylsulfanylmethanethioate is sourced from PubChem (CID 11459805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).