C13H14O4S — CID 11459806
(1R,5S)-5-methyl-1-(4-methylphenyl)sulfonyl-6-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 11459806) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is (1R,5S)-5-methyl-1-(4-methylphenyl)sulfonyl-6-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,5S)-5-methyl-1-(4-methylphenyl)sulfonyl-6-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 11459806 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | (1R,5S)-5-methyl-1-(4-methylphenyl)sulfonyl-6-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | Cc1ccc(S(=O)(=O)[C@]23O[C@@]2(C)CCC3=O)cc1 |
| InChI | InChI=1S/C13H14O4S/c1-9-3-5-10(6-4-9)18(15,16)13-11(14)7-8-12(13,2)17-13/h3-6H,7-8H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | URWFFGLRFRZPCW-STQMWFEESA-N |
| XLogP | 1.62 |
| TPSA | 63.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|