C14H13NO4S2 — CID 114598476
2-methyl-5-[(3-methylsulfonyl-2-pyridinyl)sulfanyl]benzoic acid (PubChem CID 114598476) has the molecular formula C14H13NO4S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-methyl-5-[(3-methylsulfonyl-2-pyridinyl)sulfanyl]benzoic acid.
| Compound Name | 2-methyl-5-[(3-methylsulfonyl-2-pyridinyl)sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 114598476 |
| Molecular Formula | C14H13NO4S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-methyl-5-[(3-methylsulfonyl-2-pyridinyl)sulfanyl]benzoic acid |
| SMILES | Cc1ccc(Sc2ncccc2S(C)(=O)=O)cc1C(=O)O |
| InChI | InChI=1S/C14H13NO4S2/c1-9-5-6-10(8-11(9)14(16)17)20-13-12(21(2,18)19)4-3-7-15-13/h3-8H,1-2H3,(H,16,17) |
| InChIKey | XQRXGNILSXUQEH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |