C8H10Cl2N2OS — CID 114599174
5-chloro-4-(3-chloro-2-methylpropyl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 114599174) has the molecular formula C8H10Cl2N2OS and a molecular weight of 253.15 g/mol. Its IUPAC name is 5-chloro-4-(3-chloro-2-methylpropyl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(3-chloro-2-methylpropyl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114599174 |
| Molecular Formula | C8H10Cl2N2OS |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 5-chloro-4-(3-chloro-2-methylpropyl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | CC(CCl)CSc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H10Cl2N2OS/c1-5(2-9)3-14-8-6(10)7(13)11-4-12-8/h4-5H,2-3H2,1H3,(H,11,12,13) |
| InChIKey | ISKKIGPWDDBYCS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|