C15H16N2O3S — CID 114599393
8-[(3-methylsulfonyl-2-pyridinyl)oxy]-1,2,3,4-tetrahydroquinoline (PubChem CID 114599393) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 8-[(3-methylsulfonyl-2-pyridinyl)oxy]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-[(3-methylsulfonyl-2-pyridinyl)oxy]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 114599393 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 8-[(3-methylsulfonyl-2-pyridinyl)oxy]-1,2,3,4-tetrahydroquinoline |
| SMILES | CS(=O)(=O)c1cccnc1Oc1cccc2c1NCCC2 |
| InChI | InChI=1S/C15H16N2O3S/c1-21(18,19)13-8-4-10-17-15(13)20-12-7-2-5-11-6-3-9-16-14(11)12/h2,4-5,7-8,10,16H,3,6,9H2,1H3 |
| InChIKey | OWSACDIHMFVQJQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |