C14H24OS2 — CID 11459974
(1R,2S,3R)-3-(1,3-dithian-2-yl)-2,3-dimethyl-2-prop-2-enylcyclopentan-1-ol (PubChem CID 11459974) has the molecular formula C14H24OS2 and a molecular weight of 272.48 g/mol. Its IUPAC name is (1R,2S,3R)-3-(1,3-dithian-2-yl)-2,3-dimethyl-2-prop-2-enylcyclopentan-1-ol.
| Compound Name | (1R,2S,3R)-3-(1,3-dithian-2-yl)-2,3-dimethyl-2-prop-2-enylcyclopentan-1-ol |
|---|---|
| PubChem CID | 11459974 |
| Molecular Formula | C14H24OS2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (1R,2S,3R)-3-(1,3-dithian-2-yl)-2,3-dimethyl-2-prop-2-enylcyclopentan-1-ol |
| SMILES | C=CC[C@]1(C)[C@H](O)CC[C@@]1(C)C1SCCCS1 |
| InChI | InChI=1S/C14H24OS2/c1-4-7-13(2)11(15)6-8-14(13,3)12-16-9-5-10-17-12/h4,11-12,15H,1,5-10H2,2-3H3/t11-,13-,14+/m1/s1 |
| InChIKey | DSTJYWORXOQFMD-BNOWGMLFSA-N |
| XLogP | 3.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|