C15H20O — CID 114601106
1-(3-cyclobutylphenyl)-1-cyclopropylethanol (PubChem CID 114601106) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-(3-cyclobutylphenyl)-1-cyclopropylethanol.
| Compound Name | 1-(3-cyclobutylphenyl)-1-cyclopropylethanol |
|---|---|
| PubChem CID | 114601106 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-(3-cyclobutylphenyl)-1-cyclopropylethanol |
| SMILES | CC(O)(c1cccc(C2CCC2)c1)C1CC1 |
| InChI | InChI=1S/C15H20O/c1-15(16,13-8-9-13)14-7-3-6-12(10-14)11-4-2-5-11/h3,6-7,10-11,13,16H,2,4-5,8-9H2,1H3 |
| InChIKey | ILXUXBQJDXXSKC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |