C15H22O2 — CID 114601512
3-(3-cyclobutylphenoxy)-2,2-dimethylpropan-1-ol (PubChem CID 114601512) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 3-(3-cyclobutylphenoxy)-2,2-dimethylpropan-1-ol.
| Compound Name | 3-(3-cyclobutylphenoxy)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 114601512 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 3-(3-cyclobutylphenoxy)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)COc1cccc(C2CCC2)c1 |
| InChI | InChI=1S/C15H22O2/c1-15(2,10-16)11-17-14-8-4-7-13(9-14)12-5-3-6-12/h4,7-9,12,16H,3,5-6,10-11H2,1-2H3 |
| InChIKey | ZNCMXKSDTIIYLU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |