About 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine
5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine (PubChem CID 11460173) has the molecular formula C10H8N4O2S2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine.
Molecular Properties
| Compound Name | 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine |
| PubChem CID | 11460173 |
| Molecular Formula | C10H8N4O2S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine |
| SMILES | [N-]=[N+]=NC1=C(c2ccc([N+](=O)[O-])cc2)SCCS1 |
| InChI | InChI=1S/C10H8N4O2S2/c11-13-12-10-9(17-5-6-18-10)7-1-3-8(4-2-7)14(15)16/h1-4H,5-6H2 |
| InChIKey | RUYQRMXCVONVSW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine?
The IUPAC name of 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine (CID 11460173) is 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine.
What is the SMILES notation for 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine?
The canonical SMILES for 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine is [N-]=[N+]=NC1=C(c2ccc([N+](=O)[O-])cc2)SCCS1.
What is the InChIKey of 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine?
The InChIKey is RUYQRMXCVONVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4O2S2/c11-13-12-10-9(17-5-6-18-10)7-1-3-8(4-2-7)14(15)16/h1-4H,5-6H2.
What are the key properties of 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine?
5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine has a molecular weight of 280.33 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-6-(4-nitrophenyl)-2,3-dihydro-1,4-dithiine is sourced from PubChem (CID 11460173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).