About 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid
2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid (PubChem CID 11460225) has the molecular formula C10H14N6O4
and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid |
| PubChem CID | 11460225 |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid |
| SMILES | CCCn1nnnc1-c1o[nH]c(=O)c1CC(N)C(=O)O |
| InChI | InChI=1S/C10H14N6O4/c1-2-3-16-8(12-14-15-16)7-5(9(17)13-20-7)4-6(11)10(18)19/h6H,2-4,11H2,1H3,(H,13,17)(H,18,19) |
| InChIKey | LMHQGZRURJLIHN-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 152.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid?
The IUPAC name of 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid (CID 11460225) is 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid.
What is the SMILES notation for 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid?
The canonical SMILES for 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid is CCCn1nnnc1-c1o[nH]c(=O)c1CC(N)C(=O)O.
What is the InChIKey of 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid?
The InChIKey is LMHQGZRURJLIHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6O4/c1-2-3-16-8(12-14-15-16)7-5(9(17)13-20-7)4-6(11)10(18)19/h6H,2-4,11H2,1H3,(H,13,17)(H,18,19).
What are the key properties of 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid?
2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid has a molecular weight of 282.26 g/mol, XLogP of -1.01, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[3-oxo-5-(1-propyltetrazol-5-yl)-1,2-oxazol-4-yl]propanoic acid is sourced from PubChem (CID 11460225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).