C14H15FO5 — CID 11460226
(1R,4R,5R)-1-[(4-fluorophenyl)methoxy]-4,5-dihydroxycyclohex-2-ene-1-carboxylic acid (PubChem CID 11460226) has the molecular formula C14H15FO5 and a molecular weight of 282.27 g/mol. Its IUPAC name is (1R,4R,5R)-1-[(4-fluorophenyl)methoxy]-4,5-dihydroxycyclohex-2-ene-1-carboxylic acid.
| Compound Name | (1R,4R,5R)-1-[(4-fluorophenyl)methoxy]-4,5-dihydroxycyclohex-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 11460226 |
| Molecular Formula | C14H15FO5 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (1R,4R,5R)-1-[(4-fluorophenyl)methoxy]-4,5-dihydroxycyclohex-2-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@]1(OCc2ccc(F)cc2)C=C[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C14H15FO5/c15-10-3-1-9(2-4-10)8-20-14(13(18)19)6-5-11(16)12(17)7-14/h1-6,11-12,16-17H,7-8H2,(H,18,19)/t11-,12-,14+/m1/s1 |
| InChIKey | DAGIIEFJESMBIA-BZPMIXESSA-N |
| XLogP | 0.85 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|