C15H26O3Si — CID 11460246
(1R,4aS,6R)-1-but-3-enoxy-7-trimethylsilyl-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyran-6-ol (PubChem CID 11460246) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is (1R,4aS,6R)-1-but-3-enoxy-7-trimethylsilyl-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyran-6-ol.
| Compound Name | (1R,4aS,6R)-1-but-3-enoxy-7-trimethylsilyl-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyran-6-ol |
|---|---|
| PubChem CID | 11460246 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (1R,4aS,6R)-1-but-3-enoxy-7-trimethylsilyl-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyran-6-ol |
| SMILES | C=CCCO[C@@H]1OCC[C@H]2C[C@@H](O)C([Si](C)(C)C)=C21 |
| InChI | InChI=1S/C15H26O3Si/c1-5-6-8-17-15-13-11(7-9-18-15)10-12(16)14(13)19(2,3)4/h5,11-12,15-16H,1,6-10H2,2-4H3/t11-,12+,15+/m0/s1 |
| InChIKey | OUQNAFMUABYGLU-YWPYICTPSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|