C18H26O2 — CID 114602493
(3-cyclobutylphenyl)-(1-methoxycyclohexyl)methanol (PubChem CID 114602493) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (3-cyclobutylphenyl)-(1-methoxycyclohexyl)methanol.
| Compound Name | (3-cyclobutylphenyl)-(1-methoxycyclohexyl)methanol |
|---|---|
| PubChem CID | 114602493 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (3-cyclobutylphenyl)-(1-methoxycyclohexyl)methanol |
| SMILES | COC1(C(O)c2cccc(C3CCC3)c2)CCCCC1 |
| InChI | InChI=1S/C18H26O2/c1-20-18(11-3-2-4-12-18)17(19)16-10-6-9-15(13-16)14-7-5-8-14/h6,9-10,13-14,17,19H,2-5,7-8,11-12H2,1H3 |
| InChIKey | QKFIOFWRYMKVBO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |