C14H21NO — CID 114602794
1-(3-cyclobutylphenyl)-2-methoxy-N-methylethanamine (PubChem CID 114602794) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-(3-cyclobutylphenyl)-2-methoxy-N-methylethanamine.
| Compound Name | 1-(3-cyclobutylphenyl)-2-methoxy-N-methylethanamine |
|---|---|
| PubChem CID | 114602794 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1-(3-cyclobutylphenyl)-2-methoxy-N-methylethanamine |
| SMILES | CNC(COC)c1cccc(C2CCC2)c1 |
| InChI | InChI=1S/C14H21NO/c1-15-14(10-16-2)13-8-4-7-12(9-13)11-5-3-6-11/h4,7-9,11,14-15H,3,5-6,10H2,1-2H3 |
| InChIKey | RVXVQDFHDUQXPE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |