4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid

C9H10ClNO4S — CID 114603950

IUPAC4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid
SMILESO=C(O)c1cc(Cl)cn1C1CCS(=O)(=O)C1
InChIInChI=1S/C9H10ClNO4S/c10-6-3-8(9(12)13)11(4-6)7-1-2-16(14,15)5-7/h3-4,7H,1-2,5H2,(H,12,13)
InChIKeyKCDCHUXRCAYRCT-UHFFFAOYSA-N
MW263.70 g/mol
LogP1.20
Rot. Bonds2

About 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid

4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid (PubChem CID 114603950) has the molecular formula C9H10ClNO4S and a molecular weight of 263.70 g/mol. Its IUPAC name is 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid.

Molecular Properties

Compound Name4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid
PubChem CID114603950
Molecular FormulaC9H10ClNO4S
Molecular Weight263.70 g/mol
Exact Mass263.00
IUPAC Name4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid
SMILESO=C(O)c1cc(Cl)cn1C1CCS(=O)(=O)C1
InChIInChI=1S/C9H10ClNO4S/c10-6-3-8(9(12)13)11(4-6)7-1-2-16(14,15)5-7/h3-4,7H,1-2,5H2,(H,12,13)
InChIKeyKCDCHUXRCAYRCT-UHFFFAOYSA-N
XLogP1.20
TPSA76.37 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.70
LogP ≤ 51.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid?
The IUPAC name of 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid (CID 114603950) is 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid.
What is the SMILES notation for 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid?
The canonical SMILES for 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid is O=C(O)c1cc(Cl)cn1C1CCS(=O)(=O)C1.
What is the InChIKey of 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid?
The InChIKey is KCDCHUXRCAYRCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO4S/c10-6-3-8(9(12)13)11(4-6)7-1-2-16(14,15)5-7/h3-4,7H,1-2,5H2,(H,12,13).
What are the key properties of 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid?
4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid has a molecular weight of 263.70 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid is sourced from PubChem (CID 114603950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).