C9H10ClNO4S — CID 114603950
4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid (PubChem CID 114603950) has the molecular formula C9H10ClNO4S and a molecular weight of 263.70 g/mol. Its IUPAC name is 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid.
| Compound Name | 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114603950 |
| Molecular Formula | C9H10ClNO4S |
| Molecular Weight | 263.70 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 4-chloro-1-(1,1-dioxothiolan-3-yl)pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)cn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H10ClNO4S/c10-6-3-8(9(12)13)11(4-6)7-1-2-16(14,15)5-7/h3-4,7H,1-2,5H2,(H,12,13) |
| InChIKey | KCDCHUXRCAYRCT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.70 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |