C16H18O5 — CID 11460473
[(1R,2S,3S,8R,10R,11S)-6,9-dioxo-5-oxatetracyclo[9.2.1.02,10.03,8]tetradec-12-en-2-yl]methyl acetate (PubChem CID 11460473) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is [(1R,2S,3S,8R,10R,11S)-6,9-dioxo-5-oxatetracyclo[9.2.1.02,10.03,8]tetradec-12-en-2-yl]methyl acetate.
| Compound Name | [(1R,2S,3S,8R,10R,11S)-6,9-dioxo-5-oxatetracyclo[9.2.1.02,10.03,8]tetradec-12-en-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11460473 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [(1R,2S,3S,8R,10R,11S)-6,9-dioxo-5-oxatetracyclo[9.2.1.02,10.03,8]tetradec-12-en-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12[C@H](C(=O)[C@@H]3CC(=O)OC[C@@H]31)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C16H18O5/c1-8(17)21-7-16-10-3-2-9(4-10)14(16)15(19)11-5-13(18)20-6-12(11)16/h2-3,9-12,14H,4-7H2,1H3/t9-,10+,11-,12+,14+,16-/m1/s1 |
| InChIKey | VESVJSWIFSBMCZ-KYTKKLGHSA-N |
| XLogP | 1.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|