C12H13NO2 — CID 11460495
(4aR,9aS)-3-methoxy-2,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazine (PubChem CID 11460495) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (4aR,9aS)-3-methoxy-2,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazine.
| Compound Name | (4aR,9aS)-3-methoxy-2,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazine |
|---|---|
| PubChem CID | 11460495 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (4aR,9aS)-3-methoxy-2,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazine |
| SMILES | COC1=N[C@@H]2c3ccccc3C[C@@H]2OC1 |
| InChI | InChI=1S/C12H13NO2/c1-14-11-7-15-10-6-8-4-2-3-5-9(8)12(10)13-11/h2-5,10,12H,6-7H2,1H3/t10-,12+/m0/s1 |
| InChIKey | UOKUWQIMULFKTO-CMPLNLGQSA-N |
| XLogP | 1.73 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |