C18H18O2 — CID 114605041
2-(3-cyclobutylphenyl)-5-methylbenzoic acid (PubChem CID 114605041) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-(3-cyclobutylphenyl)-5-methylbenzoic acid.
| Compound Name | 2-(3-cyclobutylphenyl)-5-methylbenzoic acid |
|---|---|
| PubChem CID | 114605041 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(3-cyclobutylphenyl)-5-methylbenzoic acid |
| SMILES | Cc1ccc(-c2cccc(C3CCC3)c2)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H18O2/c1-12-8-9-16(17(10-12)18(19)20)15-7-3-6-14(11-15)13-4-2-5-13/h3,6-11,13H,2,4-5H2,1H3,(H,19,20) |
| InChIKey | FECZGHXZNCGQAL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |