About 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine
3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine (PubChem CID 11460531) has the molecular formula C19H33NO
and a molecular weight of 291.48 g/mol. Its IUPAC name is 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine.
Molecular Properties
| Compound Name | 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine |
| PubChem CID | 11460531 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine |
| SMILES | CCC(C)(C)c1cccc(C(C)(C)CC)c1OCCCN |
| InChI | InChI=1S/C19H33NO/c1-7-18(3,4)15-11-9-12-16(19(5,6)8-2)17(15)21-14-10-13-20/h9,11-12H,7-8,10,13-14,20H2,1-6H3 |
| InChIKey | DXDRHDVJRUVMGW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine?
The IUPAC name of 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine (CID 11460531) is 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine.
What is the SMILES notation for 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine?
The canonical SMILES for 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine is CCC(C)(C)c1cccc(C(C)(C)CC)c1OCCCN.
What is the InChIKey of 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine?
The InChIKey is DXDRHDVJRUVMGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33NO/c1-7-18(3,4)15-11-9-12-16(19(5,6)8-2)17(15)21-14-10-13-20/h9,11-12H,7-8,10,13-14,20H2,1-6H3.
What are the key properties of 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine?
3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine has a molecular weight of 291.48 g/mol, XLogP of 4.79, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-bis(2-methylbutan-2-yl)phenoxy]propan-1-amine is sourced from PubChem (CID 11460531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).