C16H20O3S — CID 11460566
methyl (2R)-2-[(1R)-2-[(S)-(4-methylphenyl)sulfinyl]cyclopent-2-en-1-yl]propanoate (PubChem CID 11460566) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is methyl (2R)-2-[(1R)-2-[(S)-(4-methylphenyl)sulfinyl]cyclopent-2-en-1-yl]propanoate.
| Compound Name | methyl (2R)-2-[(1R)-2-[(S)-(4-methylphenyl)sulfinyl]cyclopent-2-en-1-yl]propanoate |
|---|---|
| PubChem CID | 11460566 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl (2R)-2-[(1R)-2-[(S)-(4-methylphenyl)sulfinyl]cyclopent-2-en-1-yl]propanoate |
| SMILES | COC(=O)[C@H](C)[C@H]1CCC=C1[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H20O3S/c1-11-7-9-13(10-8-11)20(18)15-6-4-5-14(15)12(2)16(17)19-3/h6-10,12,14H,4-5H2,1-3H3/t12-,14-,20+/m1/s1 |
| InChIKey | NFNKDGZDNWEKPT-ZGLRSVDFSA-N |
| XLogP | 3.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |