C13H11BrClNO2 — CID 114606233
1-(2-bromo-4,6-dimethylphenyl)-4-chloropyrrole-2-carboxylic acid (PubChem CID 114606233) has the molecular formula C13H11BrClNO2 and a molecular weight of 328.59 g/mol. Its IUPAC name is 1-(2-bromo-4,6-dimethylphenyl)-4-chloropyrrole-2-carboxylic acid.
| Compound Name | 1-(2-bromo-4,6-dimethylphenyl)-4-chloropyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114606233 |
| Molecular Formula | C13H11BrClNO2 |
| Molecular Weight | 328.59 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 1-(2-bromo-4,6-dimethylphenyl)-4-chloropyrrole-2-carboxylic acid |
| SMILES | Cc1cc(C)c(-n2cc(Cl)cc2C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C13H11BrClNO2/c1-7-3-8(2)12(10(14)4-7)16-6-9(15)5-11(16)13(17)18/h3-6H,1-2H3,(H,17,18) |
| InChIKey | FVQHIKKONRKJCX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |