C16H17ClN2 — CID 114606781
3-chloro-6-(2-cyclobutylphenyl)-4,5-dimethylpyridazine (PubChem CID 114606781) has the molecular formula C16H17ClN2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 3-chloro-6-(2-cyclobutylphenyl)-4,5-dimethylpyridazine.
| Compound Name | 3-chloro-6-(2-cyclobutylphenyl)-4,5-dimethylpyridazine |
|---|---|
| PubChem CID | 114606781 |
| Molecular Formula | C16H17ClN2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3-chloro-6-(2-cyclobutylphenyl)-4,5-dimethylpyridazine |
| SMILES | Cc1c(Cl)nnc(-c2ccccc2C2CCC2)c1C |
| InChI | InChI=1S/C16H17ClN2/c1-10-11(2)16(17)19-18-15(10)14-9-4-3-8-13(14)12-6-5-7-12/h3-4,8-9,12H,5-7H2,1-2H3 |
| InChIKey | DPUMKZIDVLHKEJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |