C18H25NO — CID 114607601
2-(1-aminocyclohexyl)-1-(3-cyclobutylphenyl)ethanone (PubChem CID 114607601) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-(1-aminocyclohexyl)-1-(3-cyclobutylphenyl)ethanone.
| Compound Name | 2-(1-aminocyclohexyl)-1-(3-cyclobutylphenyl)ethanone |
|---|---|
| PubChem CID | 114607601 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-(1-aminocyclohexyl)-1-(3-cyclobutylphenyl)ethanone |
| SMILES | NC1(CC(=O)c2cccc(C3CCC3)c2)CCCCC1 |
| InChI | InChI=1S/C18H25NO/c19-18(10-2-1-3-11-18)13-17(20)16-9-5-8-15(12-16)14-6-4-7-14/h5,8-9,12,14H,1-4,6-7,10-11,13,19H2 |
| InChIKey | OKMDYFOLCLQXBW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |