About 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid
2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid (PubChem CID 114608988) has the molecular formula C12H12F2N2O3
and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid |
| PubChem CID | 114608988 |
| Molecular Formula | C12H12F2N2O3 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid |
| SMILES | C#CCN(CC(=O)O)C(=O)c1cccn1CC(F)F |
| InChI | InChI=1S/C12H12F2N2O3/c1-2-5-16(8-11(17)18)12(19)9-4-3-6-15(9)7-10(13)14/h1,3-4,6,10H,5,7-8H2,(H,17,18) |
| InChIKey | CWYNXTGEULHSGC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid?
The IUPAC name of 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid (CID 114608988) is 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid.
What is the SMILES notation for 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid?
The canonical SMILES for 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid is C#CCN(CC(=O)O)C(=O)c1cccn1CC(F)F.
What is the InChIKey of 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid?
The InChIKey is CWYNXTGEULHSGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2N2O3/c1-2-5-16(8-11(17)18)12(19)9-4-3-6-15(9)7-10(13)14/h1,3-4,6,10H,5,7-8H2,(H,17,18).
What are the key properties of 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid?
2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid has a molecular weight of 270.24 g/mol, XLogP of 0.91, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]-prop-2-ynylamino]acetic acid is sourced from PubChem (CID 114608988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).