C12H20N2O3 — CID 114609488
N-ethyl-N-(2-hydroxyethyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide (PubChem CID 114609488) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxyethyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide.
| Compound Name | N-ethyl-N-(2-hydroxyethyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114609488 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | N-ethyl-N-(2-hydroxyethyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide |
| SMILES | CCN(CCO)C(=O)c1cccn1CCOC |
| InChI | InChI=1S/C12H20N2O3/c1-3-13(7-9-15)12(16)11-5-4-6-14(11)8-10-17-2/h4-6,15H,3,7-10H2,1-2H3 |
| InChIKey | KCRSVSMAYBYUCM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |