C14H15F2N3O2 — CID 114610106
N-(4-amino-3-methoxyphenyl)-1-(2,2-difluoroethyl)pyrrole-2-carboxamide (PubChem CID 114610106) has the molecular formula C14H15F2N3O2 and a molecular weight of 295.29 g/mol. Its IUPAC name is N-(4-amino-3-methoxyphenyl)-1-(2,2-difluoroethyl)pyrrole-2-carboxamide.
| Compound Name | N-(4-amino-3-methoxyphenyl)-1-(2,2-difluoroethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114610106 |
| Molecular Formula | C14H15F2N3O2 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-(4-amino-3-methoxyphenyl)-1-(2,2-difluoroethyl)pyrrole-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cccn2CC(F)F)ccc1N |
| InChI | InChI=1S/C14H15F2N3O2/c1-21-12-7-9(4-5-10(12)17)18-14(20)11-3-2-6-19(11)8-13(15)16/h2-7,13H,8,17H2,1H3,(H,18,20) |
| InChIKey | YEUHANQCCNHAQK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|