C14H19N3O3 — CID 114610402
1-(1-cyclobutylpyrrole-2-carbonyl)piperazine-2-carboxylic acid (PubChem CID 114610402) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-(1-cyclobutylpyrrole-2-carbonyl)piperazine-2-carboxylic acid.
| Compound Name | 1-(1-cyclobutylpyrrole-2-carbonyl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 114610402 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-(1-cyclobutylpyrrole-2-carbonyl)piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CNCCN1C(=O)c1cccn1C1CCC1 |
| InChI | InChI=1S/C14H19N3O3/c18-13(17-8-6-15-9-12(17)14(19)20)11-5-2-7-16(11)10-3-1-4-10/h2,5,7,10,12,15H,1,3-4,6,8-9H2,(H,19,20) |
| InChIKey | OLVQLZCNFHATMC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |