C13H16F3N3O — CID 114610462
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[1-(2,2,2-trifluoroethyl)pyrrol-2-yl]methanone (PubChem CID 114610462) has the molecular formula C13H16F3N3O and a molecular weight of 287.28 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[1-(2,2,2-trifluoroethyl)pyrrol-2-yl]methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[1-(2,2,2-trifluoroethyl)pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 114610462 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[1-(2,2,2-trifluoroethyl)pyrrol-2-yl]methanone |
| SMILES | O=C(c1cccn1CC(F)(F)F)N1CC2CNCC2C1 |
| InChI | InChI=1S/C13H16F3N3O/c14-13(15,16)8-18-3-1-2-11(18)12(20)19-6-9-4-17-5-10(9)7-19/h1-3,9-10,17H,4-8H2 |
| InChIKey | SZBZHMRGXDBBCS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |