C14H23N3O2 — CID 114610635
1-cyclobutyl-N-[2-(2-methoxyethylamino)ethyl]pyrrole-2-carboxamide (PubChem CID 114610635) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-cyclobutyl-N-[2-(2-methoxyethylamino)ethyl]pyrrole-2-carboxamide.
| Compound Name | 1-cyclobutyl-N-[2-(2-methoxyethylamino)ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114610635 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-cyclobutyl-N-[2-(2-methoxyethylamino)ethyl]pyrrole-2-carboxamide |
| SMILES | COCCNCCNC(=O)c1cccn1C1CCC1 |
| InChI | InChI=1S/C14H23N3O2/c1-19-11-9-15-7-8-16-14(18)13-6-3-10-17(13)12-4-2-5-12/h3,6,10,12,15H,2,4-5,7-9,11H2,1H3,(H,16,18) |
| InChIKey | MGEDJCDLCGWMIC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|