About ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate
ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 11461094) has the molecular formula C17H29NO4
and a molecular weight of 311.42 g/mol. Its IUPAC name is ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| PubChem CID | 11461094 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CC[C@@H]1CC[C@@H](C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO4/c1-8-9-12-10-11-13(14(19)21-16(2,3)4)18(12)15(20)22-17(5,6)7/h8,12-13H,1,9-11H2,2-7H3/t12-,13+/m1/s1 |
| InChIKey | CCHCWNFUVHNBAL-OLZOCXBDSA-N |
| XLogP | 3.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate?
The IUPAC name of ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate (CID 11461094) is ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate?
The canonical SMILES for ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate is C=CC[C@@H]1CC[C@@H](C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate?
The InChIKey is CCHCWNFUVHNBAL-OLZOCXBDSA-N. The full InChI is InChI=1S/C17H29NO4/c1-8-9-12-10-11-13(14(19)21-16(2,3)4)18(12)15(20)22-17(5,6)7/h8,12-13H,1,9-11H2,2-7H3/t12-,13+/m1/s1.
What are the key properties of ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate?
ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate has a molecular weight of 311.42 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2S,5S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 11461094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).