C18H21NO4 — CID 11461200
dimethyl 1-benzyl-5-methyl-4,5-dihydroazepine-2,3-dicarboxylate (PubChem CID 11461200) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is dimethyl 1-benzyl-5-methyl-4,5-dihydroazepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-5-methyl-4,5-dihydroazepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11461200 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | dimethyl 1-benzyl-5-methyl-4,5-dihydroazepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(Cc2ccccc2)C=CC(C)C1 |
| InChI | InChI=1S/C18H21NO4/c1-13-9-10-19(12-14-7-5-4-6-8-14)16(18(21)23-3)15(11-13)17(20)22-2/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | AJOMNAFOHJKXTG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |