C17H23NO3S — CID 11461403
(4R,9aR)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one (PubChem CID 11461403) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is (4R,9aR)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one.
| Compound Name | (4R,9aR)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
|---|---|
| PubChem CID | 11461403 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (4R,9aR)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)C2C(=O)C[C@H]3CCCCN3[C@@H]2C)cc1 |
| InChI | InChI=1S/C17H23NO3S/c1-12-6-8-15(9-7-12)22(20,21)17-13(2)18-10-4-3-5-14(18)11-16(17)19/h6-9,13-14,17H,3-5,10-11H2,1-2H3/t13-,14-,17?/m1/s1 |
| InChIKey | JNOFGFOTPLKYML-LJNCCCJHSA-N |
| XLogP | 2.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |