C12H12N4O2S2 — CID 114614077
5-[(3-methyl-2-pyridinyl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 114614077) has the molecular formula C12H12N4O2S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 5-[(3-methyl-2-pyridinyl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[(3-methyl-2-pyridinyl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614077 |
| Molecular Formula | C12H12N4O2S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 5-[(3-methyl-2-pyridinyl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | Cc1cccnc1NS(=O)(=O)c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C12H12N4O2S2/c1-8-3-2-6-14-12(8)16-20(17,18)9-4-5-10(11(13)19)15-7-9/h2-7H,1H3,(H2,13,19)(H,14,16) |
| InChIKey | AEXOREXQOKKMGH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|