About 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide
5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide (PubChem CID 114614462) has the molecular formula C12H16N4O3S2
and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide.
Molecular Properties
| Compound Name | 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide |
| PubChem CID | 114614462 |
| Molecular Formula | C12H16N4O3S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide |
| SMILES | CC1(C)C(=O)NCCN1S(=O)(=O)c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C12H16N4O3S2/c1-12(2)11(17)14-5-6-16(12)21(18,19)8-3-4-9(10(13)20)15-7-8/h3-4,7H,5-6H2,1-2H3,(H2,13,20)(H,14,17) |
| InChIKey | QOSBCHMFEODNIN-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide?
The IUPAC name of 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide (CID 114614462) is 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide.
What is the SMILES notation for 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide?
The canonical SMILES for 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide is CC1(C)C(=O)NCCN1S(=O)(=O)c1ccc(C(N)=S)nc1.
What is the InChIKey of 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide?
The InChIKey is QOSBCHMFEODNIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O3S2/c1-12(2)11(17)14-5-6-16(12)21(18,19)8-3-4-9(10(13)20)15-7-8/h3-4,7H,5-6H2,1-2H3,(H2,13,20)(H,14,17).
What are the key properties of 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide?
5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide has a molecular weight of 328.42 g/mol, XLogP of -0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpyridine-2-carbothioamide is sourced from PubChem (CID 114614462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).