C11H19F3N2 — CID 114615812
N-(2-methylprop-2-enyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 114615812) has the molecular formula C11H19F3N2 and a molecular weight of 236.28 g/mol. Its IUPAC name is N-(2-methylprop-2-enyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | N-(2-methylprop-2-enyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 114615812 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N-(2-methylprop-2-enyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | C=C(C)CNC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3N2/c1-9(2)7-15-10-3-5-16(6-4-10)8-11(12,13)14/h10,15H,1,3-8H2,2H3 |
| InChIKey | BPYVNDZJQNVIPT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|