About cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate
cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate (PubChem CID 11461681) has the molecular formula C15H16F3NO4
and a molecular weight of 331.29 g/mol. Its IUPAC name is cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate |
| PubChem CID | 11461681 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(NC(=O)OCc2ccccc2)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO4/c1-2-22-12(20)14(8-11(14)15(16,17)18)19-13(21)23-9-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H,19,21)/t11-,14-/m0/s1 |
| InChIKey | TVEBHZKHWRTHLF-FZMZJTMJSA-N |
| XLogP | 2.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate?
The IUPAC name of cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate (CID 11461681) is cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate?
The canonical SMILES for cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate is CCOC(=O)[C@]1(NC(=O)OCc2ccccc2)C[C@@H]1C(F)(F)F.
What is the InChIKey of cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate?
The InChIKey is TVEBHZKHWRTHLF-FZMZJTMJSA-N. The full InChI is InChI=1S/C15H16F3NO4/c1-2-22-12(20)14(8-11(14)15(16,17)18)19-13(21)23-9-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H,19,21)/t11-,14-/m0/s1.
What are the key properties of cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate?
cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate has a molecular weight of 331.29 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1S,2S)-1-(phenylmethoxycarbonylamino)-2-(trifluoromethyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 11461681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).