C9H16N2 — CID 114616828
N-(2-methylprop-2-enyl)-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 114616828) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N-(2-methylprop-2-enyl)-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | N-(2-methylprop-2-enyl)-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 114616828 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N-(2-methylprop-2-enyl)-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | C=C(C)CNC1=NCCCC1 |
| InChI | InChI=1S/C9H16N2/c1-8(2)7-11-9-5-3-4-6-10-9/h1,3-7H2,2H3,(H,10,11) |
| InChIKey | PVLLQOHLLABHJA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|