About 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine
5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine (PubChem CID 114617717) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine |
| PubChem CID | 114617717 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine |
| SMILES | C=C(C)CNc1nnc(C)s1 |
| InChI | InChI=1S/C7H11N3S/c1-5(2)4-8-7-10-9-6(3)11-7/h1,4H2,2-3H3,(H,8,10) |
| InChIKey | FROKFOLGMIWARH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine (CID 114617717) is 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine is C=C(C)CNc1nnc(C)s1.
What is the InChIKey of 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine?
The InChIKey is FROKFOLGMIWARH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3S/c1-5(2)4-8-7-10-9-6(3)11-7/h1,4H2,2-3H3,(H,8,10).
What are the key properties of 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine?
5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine has a molecular weight of 169.25 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(2-methylprop-2-enyl)-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 114617717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).