C12H20N2O3 — CID 114618094
2-[1-(2-methylprop-2-enylcarbamoyl)piperidin-2-yl]acetic acid (PubChem CID 114618094) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-[1-(2-methylprop-2-enylcarbamoyl)piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-(2-methylprop-2-enylcarbamoyl)piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 114618094 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-[1-(2-methylprop-2-enylcarbamoyl)piperidin-2-yl]acetic acid |
| SMILES | C=C(C)CNC(=O)N1CCCCC1CC(=O)O |
| InChI | InChI=1S/C12H20N2O3/c1-9(2)8-13-12(17)14-6-4-3-5-10(14)7-11(15)16/h10H,1,3-8H2,2H3,(H,13,17)(H,15,16) |
| InChIKey | QEZYDATZPRGGHE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|