C13H17NOS — CID 114618800
2-(2-methylphenyl)sulfanyl-N-(2-methylprop-2-enyl)acetamide (PubChem CID 114618800) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-(2-methylphenyl)sulfanyl-N-(2-methylprop-2-enyl)acetamide.
| Compound Name | 2-(2-methylphenyl)sulfanyl-N-(2-methylprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 114618800 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-(2-methylphenyl)sulfanyl-N-(2-methylprop-2-enyl)acetamide |
| SMILES | C=C(C)CNC(=O)CSc1ccccc1C |
| InChI | InChI=1S/C13H17NOS/c1-10(2)8-14-13(15)9-16-12-7-5-4-6-11(12)3/h4-7H,1,8-9H2,2-3H3,(H,14,15) |
| InChIKey | YPQGQTHDHWNZIR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|