C14H22N2O2 — CID 114619330
8-ethyl-9-(2-methylprop-2-enyl)-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 114619330) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 8-ethyl-9-(2-methylprop-2-enyl)-6,9-diazaspiro[4.5]decane-7,10-dione.
| Compound Name | 8-ethyl-9-(2-methylprop-2-enyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 114619330 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 8-ethyl-9-(2-methylprop-2-enyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | C=C(C)CN1C(=O)C2(CCCC2)NC(=O)C1CC |
| InChI | InChI=1S/C14H22N2O2/c1-4-11-12(17)15-14(7-5-6-8-14)13(18)16(11)9-10(2)3/h11H,2,4-9H2,1,3H3,(H,15,17) |
| InChIKey | KCATXBTWVDODSK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|