C6H11N5 — CID 114619395
3-N-(2-methylprop-2-enyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 114619395) has the molecular formula C6H11N5 and a molecular weight of 153.19 g/mol. Its IUPAC name is 3-N-(2-methylprop-2-enyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(2-methylprop-2-enyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 114619395 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 3-N-(2-methylprop-2-enyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | C=C(C)CNc1n[nH]c(N)n1 |
| InChI | InChI=1S/C6H11N5/c1-4(2)3-8-6-9-5(7)10-11-6/h1,3H2,2H3,(H4,7,8,9,10,11) |
| InChIKey | QAEKRTIFZXEIHU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|