C19H19F4N3OS — CID 1146196
1-(azepan-1-yl)-2-[4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylethanone (PubChem CID 1146196) has the molecular formula C19H19F4N3OS and a molecular weight of 413.44 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylethanone |
|---|---|
| PubChem CID | 1146196 |
| Molecular Formula | C19H19F4N3OS |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylethanone |
| SMILES | O=C(CSc1nc(-c2ccc(F)cc2)cc(C(F)(F)F)n1)N1CCCCCC1 |
| InChI | InChI=1S/C19H19F4N3OS/c20-14-7-5-13(6-8-14)15-11-16(19(21,22)23)25-18(24-15)28-12-17(27)26-9-3-1-2-4-10-26/h5-8,11H,1-4,9-10,12H2 |
| InChIKey | MIZFFEMNNLWVLJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |