C18H27NO — CID 114619845
N-[(2-cyclohex-2-en-1-yloxy-5-methylphenyl)methyl]-2-methylpropan-1-amine (PubChem CID 114619845) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is N-[(2-cyclohex-2-en-1-yloxy-5-methylphenyl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-[(2-cyclohex-2-en-1-yloxy-5-methylphenyl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 114619845 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-[(2-cyclohex-2-en-1-yloxy-5-methylphenyl)methyl]-2-methylpropan-1-amine |
| SMILES | Cc1ccc(OC2C=CCCC2)c(CNCC(C)C)c1 |
| InChI | InChI=1S/C18H27NO/c1-14(2)12-19-13-16-11-15(3)9-10-18(16)20-17-7-5-4-6-8-17/h5,7,9-11,14,17,19H,4,6,8,12-13H2,1-3H3 |
| InChIKey | JHEIRHWAFJYBJW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|